barbital sodium
Barbitone sodium
CAS: 144-02-5
Molecular Formula: C8H11N2NaO3
barbital sodium - Names and Identifiers
| Name | Barbitone sodium |
| Synonyms | BARBITAL NA barbital sodium BARBITAL SODIUM Barbitonesodium Barbitone sodium BARBITONE SODIUM BARBITAL SODIUM SALT BARBITONE SODIUM SALT LABOTEST-BB LT01290084 Sodium diethylbarbiturate Sodium 5,5-diethylbarbiturate barbital sodium--dea schedule iv item 5,5-DIETHYLBARBITURIC ACID SODIUM SALT 5,5-diethylbarbituric acid sodium salt 5,5-DIETHYLBARBITURIC ACID SALT SODIUM SALT sodium 5,5-diethyl-4,6-dioxo-1,4,5,6-tetrahydropyrimidin-2-olate |
| CAS | 144-02-5 |
| EINECS | 205-613-9 |
| InChI | InChI=1/C8H12N2O3.Na/c1-3-8(4-2)5(11)9-7(13)10-6(8)12;/h3-4H2,1-2H3,(H2,9,10,11,12,13);/q;+1/p-1 |
| InChIKey | RGHFKWPGWBFQLN-UHFFFAOYSA-M |
barbital sodium - Physico-chemical Properties
| Molecular Formula | C8H11N2NaO3 |
| Molar Mass | 206.17 |
| Density | 1.418[at 20℃] |
| Melting Point | 190℃ |
| Water Solubility | 181.6g/L at 20℃ |
| Solubility | H2O: soluble50mg/mL, clear, colorless |
| Vapor Presure | 0.004Pa at 90℃ |
| Color | Bitter crystals or powder |
| Merck | 13,965 |
| BRN | 3921202 |
| Use | Used as chromatographic analysis reagents, also used in medicine, plastics and organic synthesis and other industries |
barbital sodium - Risk and Safety
| Hazard Symbols | Xn - Harmful |
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | 36 - Wear suitable protective clothing. |
| UN IDs | 3288 |
| WGK Germany | 3 |
| RTECS | CQ3850000 |
| HS Code | 29335300 |
| Hazard Class | 6.1(b) |
| Packing Group | III |
| Toxicity | TDLo orl-rat: 121 g/kg/72W-C:NEO CRNGDP11,2149,90 |
barbital sodium - Upstream Downstream Industry
| Raw Materials | Barbituric acid Sodium hydroxide |
Supplier List
View History
Raw Materials for barbital sodium